Details for 1-chloroethyl ethyl carbonate

1-chloroethyl ethyl carbonate
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
50893-36-2 |
| EC NO: |
256-832-1 |
| Molecular Formula: |
C5H9ClO3 |
| Molecular Weight: |
152.5762 |
| Specification: |
|
| InChI: |
InChI=1/C5H9ClO3/c1-3-8-5(7)9-4(2)6/h4H,3H2,1-2H3/t4-/m1/s1 |
| Synonyms: |
1-Chloroethylethylcarbonate;Carbonic acid 1-chloroethyl ethyl ester;(1R)-1-chloroethyl ethyl carbonate;(1S)-1-chloroethyl ethyl carbonate; |
| Molecular Structure: |
|
if you are sourcing 1-chloroethyl ethyl carbonate from Belgium ,just feel free to inquire