Details for Benzophenone

Benzophenone
| Category: |
Intermediates |
|
| CAS NO: |
119-61-9 |
| EC NO: |
204-337-6 |
| Molecular Formula: |
C13H10O |
| Molecular Weight: |
182.2179 |
| Specification: |
|
| InChI: |
InChI=1/C13H10O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
Product description:
White solid with a flowery odor.Fixative for heavy perfumes, such as geranium new-mown hay, especially when used in soaps. In the manufacture of antihistamines, hypnotics, insecticides. |
| Synonyms: |
Diphenyl ketone;Diphenylmethanone;melting point standard benzophenone;dipheneyl ketone;alpha-Oxodiphenylmethane;alpha-Oxoditane;Benzoylbenzene;Oxodiphenylmethane;Oxoditane;phenyl ketone;Benzophenones;Photoinitiator-BP; |
| Molecular Structure: |
|
if you are sourcing Benzophenone from Belgium ,just feel free to inquire