Details for Ethyl phenylacetate

Ethyl phenylacetate
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
101-97-3 |
| EC NO: |
202-993-8 |
| Molecular Formula: |
C10H12O2 |
| Molecular Weight: |
164.2011 |
| Specification: |
|
| InChI: |
InChI=1/C10H12O2/c1-2-12-10(11)8-9-6-4-3-5-7-9/h3-7H,2,8H2,1H3 |
| Synonyms: |
5-Fluoro-4-Hydroxy-2-Mercaptopyrimidine;Phenylacetic acid ethyl ester;Benzeneacetic acid, ethyl ester;Ethyl alpha-toluate;Ethyl phenacetate;Ethyl 2-phenylacetate; |
| Molecular Structure: |
|
if you are sourcing Ethyl phenylacetate from Belgium ,just feel free to inquire