Details for 1-Hydroxybenzotriazole

1-Hydroxybenzotriazole
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
2592-95-2 |
| EC NO: |
219-989-7 |
| Molecular Formula: |
C6H8N4O |
| Molecular Weight: |
152.1539 |
| Specification: |
|
| InChI: |
InChI=1/C6H5N3O.H3N/c10-9-6-4-2-1-3-5(6)7-8-9;/h1-4,10H;1H3 |
| Packing: |
25kgs net cardboard drum |
Product description:
Molecular Formula: C6H5N3OCAS Number: 2592-95-2Description: mp: 157-159癈SpecificationPurity: 99% min Melting point: 157-159癈Moisture: 0.5% max
|
| Synonyms: |
HOBT;N-Hydroxybenzotrizole;1-Hydroxybenzotrizole;HOBt (anhydrous);1-Hydroxy benzotriazole; |
| Molecular Structure: |
|
if you are sourcing 1-Hydroxybenzotriazole from China ,just feel free to inquire