| Category: | 
        Pharmaceuticals and Biochemicals/Herbal Plant Extract | 
        
        	 | 
      
      
        | CAS NO: | 
      54-21-7   | 
      
      
        | EC NO: | 
        
        200-198-0 | 
      
      
        | Molecular Formula: | 
        
        C7H5O3Na | 
      
					
					  | Molecular Weight: | 
                      160.1 | 
					
                    
                      | Specification: | 
                      	 | 
                    
                    
                      | InChI: | 
                      InChI=1/C7H6O3.Na/c8-6-4-2-1-3-5(6)7(9)10;/h1-4,8H,(H,9,10);/q;+1/p-1 | 
                    
                    
                      | Packing: | 
                       25kgs net cardboard drum | 
                    
                    
                      Product description: 
                          SpecificationBP 2000Appearance: white crystal thin slices or white crystal powder/ball powderAcidity: 0.2ml maxHeavy metals: 20ppm maxChloride: 200ppm maxSulphate: 600ppm maxAppearance of solution: No more than BY6, clearWater: 0.5% max Assay: 99.0-101.0% 
 
 | 
                    
                    
                      | Uses: | 
                      
                      a kind of preservative,also a important product in oil field industry | 
                    
                    
                    
                      | Synonyms: | 
                      
                      sodium salicylate usp;Salicylic acid sodium salt;salicylic acid sodium;Sodium Salicylate/Salicylic acid sodium salt;Sodium sallicylate;Salicylic acid, sodium saltSodium ;o-hydroxybenzoic sodium salt;2-Hydroxybenzoic acid sodium salt; | 
                    
					
                      | Molecular Structure: | 
                      
                       |