| Category: | 
        Catalyst and Auxiliary | 
        
        	 | 
      
      
        | CAS NO: | 
      144-55-8   | 
      
      
        | EC NO: | 
        
        205-633-8 | 
      
      
        | Molecular Formula: | 
        
        NaHCO3 | 
      
					
					  | Molecular Weight: | 
                      84.01 | 
					
                    
                      | Specification: | 
                      	 | 
                    
                    
                      | InChI: | 
                      InChI=1/CH2O3.2Na/c2-1(3)4;;/h(H2,2,3,4);;/q;2*+1/p-2 | 
                    
                    
                      | Packing: | 
                      In 25kg plastic woven bags lined with poly-bag(23MT/FCL). | 
                    
                    
                      Product description: 
                      White powder or non-transparent crystals with saline taste,odorless,with specific gravity of 2.20;soluble in water,insoluble in alcohol;stable at ordinary temperature;when heated to 70°C it begins decomposed,releases CO2 and becomes Na2CO3; it release CO2 when meet acid.
 | 
                    
                    
                      | Uses: | 
                      
                       Used as leavening agent in food industry,to produce CO2 in beverage industry and to be used in medicine industry,also in extinguishing,leather tanning,dyeing and printing,agriculture,etc. | 
                    
                    
                    
                      | Synonyms: | 
                      
                      Baking soda;Bicarbonate of soda;Carbonic acid monosodium salt;col-evac;meylon;monosodium carbonate;monosodium hydrogen carbonate;Sodium acid carbonate;sodium hydrocarbonate;Sodium Hydrogen Carbonate;soda mint;soludal;hydrogen carbonate;BICARBONATE SODIUM; | 
                    
					
                      | Molecular Structure: | 
                      
                       |