Details for Styrallyl acetate

Styrallyl acetate
| Category: |
Fragrances and Aroma chemicals |
|
| CAS NO: |
93-92-5 |
| EC NO: |
202-288-5 |
| Molecular Formula: |
C10H12O2 |
| Molecular Weight: |
164.2011 |
| Specification: |
|
| InChI: |
InChI=1/C10H12O2/c1-8(12-9(2)11)10-6-4-3-5-7-10/h3-8H,1-2H3/t8-/m1/s1 |
| Synonyms: |
alpha-Methylbenzyl acetate;Methyl phenylcarbinyl acetate;1-phenylethyl acetate;(1S)-1-phenylethyl acetate;(1R)-1-phenylethyl acetate;1-Hydroxy-1-phenylethyl acetate;Styrallyl Acetate; |
| Molecular Structure: |
|
if you are sourcing Styrallyl acetate from China ,just feel free to inquire