| Category: | 
        Organic chemicals and Derivatives/Basic organic raw materials | 
        
        	 | 
      
      
        | CAS NO: | 
      65-85-0   | 
      
      
        | EC NO: | 
        
        200-618-2 | 
      
      
        | Molecular Formula: | 
        
        C7H6O2 | 
      
					
					  | Molecular Weight: | 
                      122.1224 | 
					
                    
                      | Specification: | 
                      USP/BP/EP/JP/CP	 | 
                    
                    
                      | InChI: | 
                      InChI=1/C7H6O2/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H,8,9)/p-1 | 
                    
                    
                      | Packing: | 
                      material: 25kg cardboard drum/composite bag | 
                    
                    
                      Product description: 
                      Characters:         white crystal powder
Content:            99.5%-100.5%
Melting range:      121℃-123℃
Moisture:           ≤0.7%
Readily carbonizable substance: less deeper than Q colorimetric solution
Ignition residue:   ≤0.05%
Heavy metal:        ≤10ppm
Residual solvent:   LOD≤0.5 | 
                    
                    
                      | Uses: | 
                      
                      Medicine of disinfecting and antiseptic for dissolving skin cutin hyperplasia and skin mould infection. | 
                    
                    
                    
                      | Synonyms: | 
                      
                      Melting point standard benzoic acid;Benzoic-12C7 acid, 13C-depleted;Benzoic acid, USP Grade;4-Carboxypolystyrene;benzoate;Industrial-use benzoic acid; | 
                    
					
                      | Molecular Structure: | 
                      
                       |