Details for 4-hydroxymandelic acid

 
4-hydroxymandelic acid
 
      
        | Category: | 
        Organic chemicals and Derivatives/Acid, ester and anhydride compounds | 
        
        	 | 
      
      
        | CAS NO: | 
      7198-10-9   | 
      
      
        | EC NO: | 
        
        214-839-7 | 
      
      
        | Molecular Formula: | 
        
        C8H7O4 | 
      
					
					  | Molecular Weight: | 
                      167.1393 | 
					
                    
                      | Specification: | 
                      	 | 
                    
                    
                      | InChI: | 
                      InChI=1/C8H8O4/c9-6-3-1-5(2-4-6)7(10)8(11)12/h1-4,7,9-10H,(H,11,12)/p-1/t7-/m0/s1 | 
                    
                    
                    
                    
                    
                    
                      | Synonyms: | 
                      
                      P-hydroxy mandelic acid;4-Hydroxymandelic acid;hydroxy(4-hydroxyphenyl)acetic acid;(2R)-hydroxy(4-hydroxyphenyl)ethanoate;(2S)-hydroxy(4-hydroxyphenyl)ethanoate;4-Hydroxyphenylglycolic acid;p-Hydroxymandelic acid; | 
                    
					
                      | Molecular Structure: | 
                      
                       | 
                    
                  
 
 
 
 
if you are sourcing  4-hydroxymandelic acid from  China ,just feel free to inquire