Details for Dipropylene glycol dibenzoate

Dipropylene glycol dibenzoate
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
27138-31-4 |
| EC NO: |
248-258-5 |
| Molecular Formula: |
C20H22O5 |
| Molecular Weight: |
342.3857 |
| Specification: |
|
| InChI: |
InChI=1/C20H22O5/c1-3-17(24-19(21)15-11-7-5-8-12-15)23-18(4-2)25-20(22)16-13-9-6-10-14-16/h5-14,17-18H,3-4H2,1-2H3 |
| Synonyms: |
DPGDB;Oxydipropyl dibenzoate;2-[1-(Benzoyloxy)propan-2-yloxy]propyl benzoate;oxydipropane-3,1-diyl dibenzoate;Dipropylene glycol Dibenzoate;oxydipropane-1,1-diyl dibenzoate; |
| Molecular Structure: |
|
if you are sourcing Dipropylene glycol dibenzoate from China ,just feel free to inquire