| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
22352-19-8 |
| EC NO: |
|
| Molecular Formula: |
C28H38O19 |
| Molecular Weight: |
678.5899 |
| Specification: |
|
| InChI: |
InChI=1/C28H38O19/c1-11(29)37-9-19-21(39-13(3)31)23(40-14(4)32)26(43-17(7)35)28(46-19)47-22-20(10-38-12(2)30)45-27(44-18(8)36)25(42-16(6)34)24(22)41-15(5)33/h19-28H,9-10H2,1-8H3/t19-,20-,21-,22-,23+,24+,25-,26-,27-,28-/m1/s1 |
| Packing: |
25kgs/drum |
Product description:
Properties: It is White crystalline powder, it is insoluble in water and easy to soluble in ethanol, chloroform etc.
Uses: It is mainly used in biochemical reaction and used as medicine intermediate.
|
| Synonyms: |
Octa-O-acetyl-beta-D-maltose;Octaacetyl-beta-maltose;1,2,3,6-tetra-O-acetyl-4-O-(2,3,4,6-tetra-O-acetyl-alpha-D-glucopyranosyl)-beta-D-glucopyranose;β-D-maltose Octaacetate; |
| Molecular Structure: |
|