| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
1197-18-8 |
| EC NO: |
214-818-2 |
| Molecular Formula: |
C8H15NO2 |
| Molecular Weight: |
157.2102 |
| Specification: |
|
| InChI: |
InChI=1/C8H15NO2/c9-5-6-1-3-7(4-2-6)8(10)11/h6-7H,1-5,9H2,(H,10,11)/t6-,7- |
| Packing: |
1kg, 25kg |
Product description:
Store in cool place. Keep container tightly closed in a dry and well-ventilated.
|
| Usage: |
Whitening, lighten spots and etc |
| Synonyms: |
trans-4-Aminomethylcyclohexane-1-carboxylate; trans-4-(Aminomethyl)cyclohexanecarboxylic acid; Amstat;amcha;trans-cyclohexanecarboxylic acid;4-(aminomethyl)cyclohexanecarboxylic acid;trans-4-(aminomethyl)cyclohexanecarboxylic acid; |
| Molecular Structure: |
|