Details for Lithium triethylborohydride

 
Lithium triethylborohydride
 
      
        | Category: | 
        Organic chemicals and Derivatives | 
        
        	 | 
      
      
        | CAS NO: | 
      22560-16-3   | 
      
      
        | EC NO: | 
        
        245-076-8 | 
      
      
        | Molecular Formula: | 
        
        C6H16BLi | 
      
					
					  | Molecular Weight: | 
                      105.9432 | 
					
                    
                      | Specification: | 
                      	 | 
                    
                    
                      | InChI: | 
                      InChI=1/C6H16B.Li/c1-4-7(5-2)6-3;/h7H,4-6H2,1-3H3;/q-1;+1 | 
                    
                    
                    
                    
                    
                    
                      | Synonyms: | 
                      
                      Lithium triethylhydroborate;super-hydride lithium triethylboro-hydride;lithium triethyl(hydrido)borate(1-);super-hydride;Lithium borohydride thiethyl;three ethyl borohydride;
 | 
                    
					
                      | Molecular Structure: | 
                      
                       | 
                    
                  
 
 
 
 
if you are sourcing  Lithium triethylborohydride from  China ,just feel free to inquire