Details for 2-Methyl-3-(methylthio) furan

2-Methyl-3-(methylthio) furan
| Category: |
Fragrances and Aroma chemicals |
|
| CAS NO: |
63012-97-5 |
| EC NO: |
|
| Molecular Formula: |
C6H8OS |
| Molecular Weight: |
128.1921 |
| Specification: |
|
| InChI: |
InChI=1/C6H8OS/c1-5-6(8-2)3-4-7-5/h3-4H,1-2H3 |
Product description:
| Appearance |
Odor |
Application |
| Yellow liquid |
Meat Aroma, Nut Aroma |
Meat Products, Seasonings |
|
| Synonyms: |
2-Methyl-Methylthio-Furan;2-methyl-3-(methylsulfanyl)furan;2-Methyl-3-(methylthio)furan; |
| Molecular Structure: |
|
if you are sourcing 2-Methyl-3-(methylthio) furan from China ,just feel free to inquire