Details for Methyl Salicylate

Methyl Salicylate
| Category: |
Intermediates |
|
| CAS NO: |
119-36-8 |
| EC NO: |
204-317-7 |
| Molecular Formula: |
C8H8O3 |
| Molecular Weight: |
152.14972 |
| Specification: |
|
| InChI: |
InChI=1/C10H14O/c1-7(2)9-5-4-8(3)10(11)6-9/h4-7,11H,1-3H3 |
| Synonyms: |
2-carbomethoxyphenol;o-hydroxybenzoic acid methyl ester;2-(methoxycarbonyl)phenol;analgit;anthrapole nd;betula;Betula oil;exagien;flucarmit;gaultheria oil;Linsal;methyl o-hydroxybenzoate;Methyl hydroxybenzoate;Metsal Liniment;oil of wintergreen;Panalgesic;teaberry oil;wintergreen oil;Winter Green Oil; Salicylic Acid Methyl Ester;Methyl-2-Hydroxybenzoate;methyl 2-hydroxybenzoate;5-isopropyl-2-methyl-phenol;wintergreen oil from gaultheria procumbens L;Wintergreen oil Gaultheria procumbens L.;Wintergreen Oil Natural;Sublimated Salicylic acid;Oils, wintergreen; |
| Molecular Structure: |
|
if you are sourcing Methyl Salicylate from China ,just feel free to inquire