Details for Methyl 3-Nitro-4-Methyl benzoate

Methyl 3-Nitro-4-Methyl benzoate
| Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
| CAS NO: |
7356-11-8 |
| EC NO: |
230-886-6 |
| Molecular Formula: |
C9H9NO4 |
| Molecular Weight: |
195.17 |
| Specification: |
|
| InChI: |
InChI=1/C9H9NO4/c1-6-3-4-7(9(11)14-2)5-8(6)10(12)13/h3-5H,1-2H3 |
| Synonyms: |
Methyl 3-Nitro-4-Methyl benzoate;4-methyl-3-nitrobenzoic acid methyl ester;Methyl3-Nitro-4-Methylbenzoate; |
| Molecular Structure: |
|
if you are sourcing Methyl 3-Nitro-4-Methyl benzoate from China ,just feel free to inquire