Details for Sodium dichloroisocyanurate dihydrate

Sodium dichloroisocyanurate dihydrate
| Category: |
Catalyst and Auxiliary |
|
| CAS NO: |
51580-86-0 |
| EC NO: |
|
| Molecular Formula: |
C3H6Cl2N3NaO5 |
| Molecular Weight: |
257.9926 |
| Specification: |
|
| InChI: |
InChI=1/C3H2Cl2N3O3.Na.2H2O/c4-7-1(9)6-2(10)8(5)3(7)11;;;/h1H,(H,6,10);;2*1H2/q-1;+1;; |
| Synonyms: |
Sodium dichloroisocyanurate dihydrate;sodium 1,5-dichloro-4,6-dioxo-1,3,5-triazinan-2-olate dihydrate;Troclosene sodium dihydrate;Sodium Dichloroisocyanurate ,dihydrate; |
| Molecular Structure: |
|
if you are sourcing Sodium dichloroisocyanurate dihydrate from China ,just feel free to inquire