Details for Ethyl Butyryl Acetate

Ethyl Butyryl Acetate
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
3249-68-1 |
| EC NO: |
221-835-9 |
| Molecular Formula: |
C8H14O3 |
| Molecular Weight: |
158.195 |
| Specification: |
|
| InChI: |
InChI=1/C8H14O3/c1-3-5-7(9)6-8(10)11-4-2/h3-6H2,1-2H3 |
| Synonyms: |
Ethyl 3-oxohexanoate;3-Oxohexanoic acid ethyl ester;Butyrylacetic acid ethyl ester~Ethyl 3-oxohexanoate~3-Oxohexanoic acid ethyl ester; |
| Molecular Structure: |
|
if you are sourcing Ethyl Butyryl Acetate from China ,just feel free to inquire