Details for Eschenmoser's Salt

Eschenmoser's Salt
| Category: |
Organic chemicals and Derivatives/Amine compounds |
|
| CAS NO: |
33797-51-2 |
| EC NO: |
251-680-2 |
| Molecular Formula: |
C3H8IN |
| Molecular Weight: |
185.0068 |
| Specification: |
|
| InChI: |
InChI=1/C3H8N.HI/c1-4(2)3;/h1H2,2-3H3;1H/q+1;/p-1 |
| Synonyms: |
Dimethyl methyleneammonium iodide;Eschenmosers iodide salt;N,N-Dimethylmethyleneiminium iodide;Eschenmoser salt;N-methyl-N-methylidenemethanaminium iodide; |
| Molecular Structure: |
|
if you are sourcing Eschenmoser's Salt from China ,just feel free to inquire