| Category: |
Catalyst and Auxiliary/Water Treatment Chemicals |
|
| CAS NO: |
2893-78-9 |
| EC NO: |
220-767-7 |
| Molecular Formula: |
C3Cl2N3NaO3 |
| Molecular Weight: |
219.9462 |
| Specification: |
powder |
| InChI: |
InChI=1/C3HCl2N3O3.Na/c4-7-1(9)6-2(10)8(5)3(7)11;/h(H,6,9,10);/q;+1/p-1 |
| Packing: |
25kg/50kg plastic drum, 50kg fiber drum ,1000kg/bag or as required packing |
Product description:
disinfectant, which can be used to disinfect drink water, prophylactic disinfection and environmental disinfection; or used in the disinfection of silk worm, animals, birds and fish. It also can be used in anti-shrinkage finishing of wool, textile bleaching, algae-removing in circulating water and chlorinated agent of rubber |
| Uses: |
hotel cleaning use |
| Synonyms: |
1-Sodium-3,5-dichloro-s-triazine-2,4,6-trione;Dichloro-s-triazine-2,4,6-(1H,3H,5H)-trione sodium salt;Sodium dichloroisocyanurate;Dichloroisocyanuric acid sodium salt;1,3-Dichloro-6-hydroxy-1,3,5-triazine-2,4-dione sodium salt;SDIC;sodium 3,5-dichloro-2,4,6-trioxo-1,3,5-triazinan-1-ide;Troclosene sodium; |
| Molecular Structure: |
|