| Category: |
Intermediates |
|
| CAS NO: |
381-73-7 |
| EC NO: |
206-839-0 |
| Molecular Formula: |
C6H3ClFNO2 |
| Molecular Weight: |
175.5449 |
| Specification: |
purity: ≥98% smoke in the air as a colorless liquid with a strong odor. Alcohol, ether, benzene and other segments. |
| InChI: |
InChI=1/C6H3ClFNO2/c7-5-4(6(10)11)1-3(8)2-9-5/h1-2H,(H,10,11) |
| Packing: |
200KG PE bucket |
Product description:
product: acid fluoride,DifluoroaceticAcid
CAS: 381-73-7
MDL Number: MFCD00004220
Molecular formula: C2H2F2O2
Molecular Weight: 96.03
Properties
Appearance Properties: smoke in the air as a colorless liquid with a strong odor. Alcohol, ether, benzene and other segments.
Refractive index n20 / D: 1.344
Boiling point: 132-134 ° C
Melting point: -1 ° C
Density: 1.526
Flash Point: 78 ° C
Specific gravity: 1.52
Refractive index: 1.344
Vapor Pressure: 25.1mmHgat 25 ° C
Product purity: ≥98%
Packing: 200KG PE bucket
Main purpose: the alcohol is organic synthesis intermediates, can be used as pesticides and herbicides
|
| Uses: |
the alcohol is organic synthesis intermediates, can be used as pesticides and herbicides |
| Synonyms: |
AI3-28548;BRN 1098588;Acetic acid, 2,2-difluoro-;Acetic acid, difluoro-;difluoroacetate; |
| Molecular Structure: |
|