Details for 1-Chloro-4-iodobenzene

1-Chloro-4-iodobenzene
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
637-87-6 |
| EC NO: |
211-305-5 |
| Molecular Formula: |
C6H4ClI |
| Molecular Weight: |
238.4534 |
| Specification: |
98% HPLC |
| InChI: |
InChI=1/C6H4ClI/c7-5-1-3-6(8)4-2-5/h1-4H |
Product description:
Melting point 52-55 oC
Boiling point 226-227 oC
Flash point 108 oC
|
| Synonyms: |
4-Chloroiodobenzene;ethyl hydrazinylacetate;P-CHLOROIODOBENZENE; |
| Molecular Structure: |
|
if you are sourcing 1-Chloro-4-iodobenzene from China ,just feel free to inquire