Details for Indole-3-carboxaldehyde

Indole-3-carboxaldehyde
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
487-89-8 |
| EC NO: |
207-665-8 |
| Molecular Formula: |
C9H7NO |
| Molecular Weight: |
145.158 |
| Specification: |
|
| InChI: |
InChI=1/C9H7NO/c11-6-7-5-10-9-4-2-1-3-8(7)9/h1-6,10H |
Product description:
Appearance: Yellow Crystal
Melting Point: 196-198
Usage: Pharmaceutical Intermediate
|
| Synonyms: |
Indole-3-carbaldehyde;3-Formylindole;Indole-3-aldehyde;1H-indole-3-carbaldehyde;4-QUINOLINEACETICACID;2-ACETAMIDO-,METHYLESTER,MONOPICRATE;AURORA KA-4265;LABOTEST-BB LT00937468;3-Indolecarboxaldehyde; |
| Molecular Structure: |
|
if you are sourcing Indole-3-carboxaldehyde from China ,just feel free to inquire