Details for Common Cnidium Fruit Extract

Common Cnidium Fruit Extract
| Category: |
Pharmaceuticals and Biochemicals/Herbal Plant Extract |
|
| CAS NO: |
484-12-8 |
| EC NO: |
|
| Molecular Formula: |
C15H16O3 |
| Molecular Weight: |
244.2857 |
| Specification: |
|
| InChI: |
InChI=1/C15H16O3/c1-10(2)4-7-12-13(17-3)8-5-11-6-9-14(16)18-15(11)12/h4-6,8-9H,7H2,1-3H3 |
| Synonyms: |
Common Cnidium Fruit Extract;7-Methoxy-8-(3-methyl-2-butenyl)-2H-1-benzopyran-2-one;7-methoxy-8-(3-methylbut-2-en-1-yl)-2H-chromen-2-one;osthol; |
| Molecular Structure: |
|
if you are sourcing Common Cnidium Fruit Extract from China ,just feel free to inquire