| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
141-32-2 |
| EC NO: |
205-480-7 |
| Molecular Formula: |
C7H12O2 |
| Molecular Weight: |
128.1616 |
| Specification: |
|
| InChI: |
InChI=1/C7H12O2/c1-3-4-5-6(2)7(8)9/h2-5H2,1H3,(H,8,9)/p-1 |
| Packing: |
180KG/DRUM OR 20MT/ISO-TANK |
Product description:
classification | intermediate organic material | CAS No. | 141-32-2 | Other Names | BA | MF | C7H12O2 | Place of Origin Packing | Shanghai, China (Mainland) 180Kg/Plastic Drum | Grade Standard | Industrial Grade | Assay | 99.5% MIN | Appearance | Colorless Transparent liquid | Application | Acrylates Resin.Coating/flocking/emulsion textile adhesive, | Brand Name | YaXing | Model Number | Industrial grade | colour | transparent |
|
| Synonyms: |
2-Propenoic acid butyl ester;Butyl 2-Propenoate;n-Butyl Acrylate;Propenoic acid n-butyl ester;butyl prop-2-enoate;2-methylidenehexanoate;BA;Butylacrylate,inhibited;acrylatedebutyle;1-butylacrylate; |
| Molecular Structure: |
|