| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
97-88-1 |
| EC NO: |
202-615-1 |
| Molecular Formula: |
C8H14O2 |
| Molecular Weight: |
142.1979 |
| Specification: |
|
| InChI: |
InChI=1/C8H14O2/c1-4-6(2)5-7(3)8(9)10/h6H,3-5H2,1-2H3,(H,9,10)/p-1 |
| Packing: |
180KG/DRUM OR 20MT/ISO-TANK |
Product description:
classification | intermediate organic material | CAS No. | 97-88-1 | Other Names | n-BMA | MF | C8H14O2 | Place of Origin Packing | Jilin, China (Mainland) 180Kg/Plastic Drum | Grade Standard | Industrial Grade | Purity | 99.5% MIN | Appearance | Colorless Transparent liquid | Application | coating, acrylate resin | Brand Name | EVONIK/Sanding | Model Number | Industrial grade | colour | transparent | name | Butyl Methacrylate 99.5% min |
|
| Synonyms: |
2-Methyl-2-Propenoic Acid Butyl Ester;2-Methyl butyl acrylate;Butyl 2-Methyl-2-Propenate;butyl 2-methyl-2-propenoate;Butyl methacrylate, stabilized with 25 ppm methylhydroquinone;n-Butyl Methacrylate;4-methyl-2-methylidenehexanoate;n-Butyl Methylacrylate;BMA; |
| Molecular Structure: |
|