Details for Benzene

 
Benzene
 
      
        | Category: | 
        Agrochemicals | 
        
        	 | 
      
      
        | CAS NO: | 
      118-69-4   | 
      
      
        | EC NO: | 
        
        204-269-7 | 
      
      
        | Molecular Formula: | 
        
        C7H6Cl2 | 
      
					
					  | Molecular Weight: | 
                      161.0285 | 
					
                    
                      | Specification: | 
                      2,6-Dichlorotoluene	 | 
                    
                    
                      | InChI: | 
                      InChI=1/C7H6Cl2/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3 | 
                    
                    
                      | Packing: | 
                      250kg/drum | 
                    
                    
                      Product description: 
                      Molecular Formula:C7H6Cl2 | 
                    
                    
                      | Uses: | 
                      
                      For Agrochemical Intermediates and Pharmaceutical Intermediates | 
                    
                    
                    
                      | Synonyms: | 
                      
                      Benzene, 1,3-dichloro-2-methyl-; 2,6-DCT;1,3-dichloro-2-methylbenzene; | 
                    
					
                      | Molecular Structure: | 
                      
                       | 
                    
                  
 
 
 
 
if you are sourcing  Benzene from  China ,just feel free to inquire