| Category: | 
        Agrochemicals/Chemical fertilizers | 
        
        	 | 
      
      
        | CAS NO: | 
      108-31-6   | 
      
      
        | EC NO: | 
        
        203-571-6 | 
      
      
        | Molecular Formula: | 
        
        C4H2O3 | 
      
					
					  | Molecular Weight: | 
                      98.05808 | 
					
                    
                      | Specification: | 
                      Maleic anhydride	 | 
                    
                    
                      | InChI: | 
                      InChI=1S/C4H2O3/c5-3-1-2-4(6)7-3/h1-2H  | 
                    
                    
                      | Packing: | 
                      25kg/bag | 
                    
                    
                      Product description: 
                      Molecular Formula:C4H2O3 | 
                    
                    
                      | Uses: | 
                      
                      It is a kind of organic synthetic raw material, its application: In plastic industry, used as plasticizer; In paper-making, used as treatment agent; In synthetic resin industry, used as unsaturated polyester resin and alkyd resin; In painting field, used  | 
                    
                    
                    
                      | Synonyms: | 
                      
                      2,5-Furandione;cis-Butenedioic anhydride;Sodium n-amylxanthate;MaleicAnhydride;MA;furan-2,5-dione;Maleic acid anhydride; | 
                    
					
                      | Molecular Structure: | 
                      
                       |