Details for Ethylene glycol diacetate

Ethylene glycol diacetate
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
111-55-7 |
| EC NO: |
203-881-1 |
| Molecular Formula: |
C6H10O4 |
| Molecular Weight: |
146.1412 |
| Specification: |
|
| InChI: |
InChI=1/C6H10O4/c1-4(7)9-6(3)10-5(2)8/h6H,1-3H3 |
| Synonyms: |
Ethanediol diacetate;Ethylene diacetate;1,2-Diacetoxyethane;Ethylene Acetate;ethane-1,2-diyl diacetate;ethane-1,2-diyl diacetate - ethane-1,2-diol (1:1);2-acetoxyethyl acetate;1-acetoxyethyl acetate;EGDA;glycol diacetate; |
| Molecular Structure: |
|
if you are sourcing Ethylene glycol diacetate from China ,just feel free to inquire