Details for Trimethyl Borate

Trimethyl Borate
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
121-43-7 |
| EC NO: |
204-468-9 |
| Molecular Formula: |
C3H9BO3 |
| Molecular Weight: |
103.91 |
| Specification: |
|
| InChI: |
InChI:1S/C3H9BO3/c1-5-4(6-2)7-3/h1-3H3 |
| Synonyms: |
Methyl borate;Trimethyl borate (Boron methoxide);Trimethyl borate, (Boric acid trimethyl ester;Boronmethoxideinmethanol;Boric acid trimethyl ester;Boron methoxide; |
| Molecular Structure: |
|
if you are sourcing Trimethyl Borate from China ,just feel free to inquire