Details for 2-(4-Chlorobenzoyl) Benzoic Acid

2-(4-Chlorobenzoyl) Benzoic Acid
| Category: |
Intermediates |
|
| CAS NO: |
85-56-3 |
| EC NO: |
201-615-9 |
| Molecular Formula: |
C14H9ClO3 |
| Molecular Weight: |
260.6725 |
| Specification: |
|
| InChI: |
InChI=1/C14H9ClO3/c15-10-7-5-9(6-8-10)13(16)11-3-1-2-4-12(11)14(17)18/h1-8H,(H,17,18) |
| Uses: |
Used as a pharmaceutical and dye intermediate for the production of 2-Chloroanthraquinone, etc. |
| Synonyms: |
2-Carboxy-4-chlorobenzophenone;2-(4-chlorobenzoyl)-benzoic acid;2-(4-Chlorobenzoyl) benzoic acid;4'-Chlorobenzophenone-2-carboxylic acid;CBB; |
| Molecular Structure: |
|
if you are sourcing 2-(4-Chlorobenzoyl) Benzoic Acid from China ,just feel free to inquire