| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
5421-46-5 |
| EC NO: |
226-540-9 |
| Molecular Formula: |
C2H7NO2S |
| Molecular Weight: |
109.1475 |
| Specification: |
|
| InChI: |
InChI=1/C2H4O2S.H3N/c3-2(4)1-5;/h5H,1H2,(H,3,4);1H3 |
Product description:
CAS: 5421-46-5;Colorless to faint pink liquid with a repulsive, skunk-like odor.
|
| Uses: |
Hair Perms, Hair Straightener, Anticorrosive |
| Synonyms: |
Ammonium mercaptoacetate;Ammonium thioglycollate solution;Hair waving agent;Acetic acid, mercapto-, monoammonium salt;;ammonium sulfanylacetate; |
| Molecular Structure: |
|