Details for Zinc Undecylenate

Zinc Undecylenate
| Category: |
Catalyst and Auxiliary |
|
| CAS NO: |
557-08-4 |
| EC NO: |
209-155-0 |
| Molecular Formula: |
C11H20O2Zn |
| Molecular Weight: |
249.6843 |
| Specification: |
|
| InChI: |
InChI=1/C11H20O2.Zn/c1-2-3-4-5-6-7-8-9-10-11(12)13;/h2H,1,3-10H2,(H,12,13); |
| Synonyms: |
Zinc undecylenate [USAN];10-Undecenoic acid, zinc salt;10-Undecenoic acid, zinc (2+) salt;Mycoseptin;NSC 402438;Tineafax;UNII-388VZ25DUR;Zinc 10-undecenoate;10-Undecenoic acid, zinc salt (2:1);Zinc diundec-10-enoate;undec-10-enoic acid - zinc (1:1); |
| Molecular Structure: |
|
if you are sourcing Zinc Undecylenate from India ,just feel free to inquire