Details for Benzyl Benzoate

Benzyl Benzoate
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
120-51-4 |
| EC NO: |
204-402-9 |
| Molecular Formula: |
C14H12O2 |
| Molecular Weight: |
212.2439 |
| Specification: |
|
| InChI: |
InChI=1/C14H12O2/c15-14(13-9-5-2-6-10-13)16-11-12-7-3-1-4-8-12/h1-10H,11H2 |
| Synonyms: |
Benzoic acid benzyl ester;Ascabin;Ascabiol;Benylate;Benzyl alcohol benzoic ester;BENZOATO DE BENCILO;Benzoic acid phenylmethyl ester;Benzyl benzene carboxylate;Benzyl phenylformate;Phenylmethyl benzoate;Scabagen;Vanzoate;Benzyl benzoate BP; |
| Molecular Structure: |
|
if you are sourcing Benzyl Benzoate from India ,just feel free to inquire