Details for RAFOXANIDE

RAFOXANIDE
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
22662-39-1 |
| EC NO: |
245-148-9 |
| Molecular Formula: |
C19H11Cl2I2NO3 |
| Molecular Weight: |
626.0105 |
| Specification: |
|
| InChI: |
InChI=1/C19H11Cl2I2NO3/c20-10-1-4-13(5-2-10)27-17-6-3-12(9-15(17)21)24-19(26)14-7-11(22)8-16(23)18(14)25/h1-9,25H,(H,24,26) |
| Packing: |
50 kg UN approved galvanized or fibre board drums with an LDPE liner. |
| Synonyms: |
N-[3-chloro-4-(4-chlorophenoxy)phenyl]-2-hydroxy-3,5-diiodo-benzamide; |
| Molecular Structure: |
|
if you are sourcing RAFOXANIDE from India ,just feel free to inquire