Details for C.I. Pigment Red 8

C.I. Pigment Red 8
| Category: |
Dyestuffs and Pigments/Pigments |
|
| CAS NO: |
6410-30-6 |
| EC NO: |
229-100-4 |
| Molecular Formula: |
C24H17ClN4O4 |
| Molecular Weight: |
460.8692 |
| Specification: |
|
| InChI: |
InChI=1/C24H17ClN4O4/c1-14-6-11-18(29(32)33)13-21(14)27-28-22-19-5-3-2-4-15(19)12-20(23(22)30)24(31)26-17-9-7-16(25)8-10-17/h2-13,27H,1H3,(H,26,31)/b28-22+ |
| Synonyms: |
12335;C.I.Pigment Red 8;P.R.8;Naphthol Red F4R;Permanent Red F4R;N-(4-chlorophenyl)-3-hydroxy-4-[(2-methyl-5-nitrophenyl)azo]-2-Naphthalenecarboxamide;Pigment Red 8;C.I. 12335;(4E)-N-(4-chlorophenyl)-4-[(2-methyl-5-nitrophenyl)hydrazono]-3-oxo-3,4-dihydronaphthalene-2-carboxamide; |
| Molecular Structure: |
|
if you are sourcing C.I. Pigment Red 8 from India ,just feel free to inquire