Details for C.I. Pigment Yellow 3

 
C.I. Pigment Yellow 3
 
      
        | Category: | 
        Dyestuffs and Pigments/Azoic Dyes | 
        
        	 | 
      
      
        | CAS NO: | 
      6486-23-3   | 
      
      
        | EC NO: | 
        
        229-355-1 | 
      
      
        | Molecular Formula: | 
        
        C16H12Cl2N4O4 | 
      
					
					  | Molecular Weight: | 
                      395.1969 | 
					
                    
                      | Specification: | 
                      	 | 
                    
                    
                      | InChI: | 
                      InChI=1/C16H12Cl2N4O4/c1-9(23)15(16(24)19-12-5-3-2-4-11(12)18)21-20-13-7-6-10(17)8-14(13)22(25)26/h2-8,15H,1H3,(H,19,24) | 
                    
                    
                    
                    
                    
                    
                      | Synonyms: | 
                      
                      C.I. 11710;C.I. Pigment Yellow 3;C.I. Pigment Yellow 3 (VAN) (8CI);Pigment Yellow 3;2-[(E)-(4-chloro-2-nitrophenyl)diazenyl]-N-(2-chlorophenyl)-3-oxobutanamide;2-(4-chloro-2-nitro-phenyl)azo-N-(2-chlorophenyl)-3-oxo-butanamide; | 
                    
					
                      | Molecular Structure: | 
                      
                       | 
                    
                  
 
 
 
 
if you are sourcing  C.I. Pigment Yellow 3 from  India ,just feel free to inquire