Details for Ethyl 2-bromobutyrate

Ethyl 2-bromobutyrate
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
533-68-6 |
| EC NO: |
208-574-6 |
| Molecular Formula: |
C6H11BrO2 |
| Molecular Weight: |
195.0543 |
| Specification: |
|
| InChI: |
InChI=1/C6H11BrO2/c1-3-5(7)6(8)9-4-2/h5H,3-4H2,1-2H3/t5-/m1/s1 |
| Synonyms: |
Ethyl 2-bromobutyrate;2-Bromobutyric acid ethyl ester;Ethyl 2-bromo butryate;Ethyl-2-Bromo Butyrate;2-Bromobutyric Acid Ethyl;2-ethyl bromobutyrate;ethyl 2-bromobutanoate;ethyl (2S)-2-bromobutanoate;ethyl (2R)-2-bromobutanoate;Ethyl-α-bromobutyrate;Ethyl-2-bromobutyrate; |
| Molecular Structure: |
|
if you are sourcing Ethyl 2-bromobutyrate from Israel ,just feel free to inquire