Details for Benzoin

Benzoin
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
119-53-9 |
| EC NO: |
209-441-5 |
| Molecular Formula: |
C14H12O2 |
| Molecular Weight: |
212.2439 |
| Specification: |
99% min |
| InChI: |
InChI=1/C14H12O2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13,15H |
| Packing: |
25 Kg polythene bags |
Product description:
CAS N.119-53-9
Slightly acrid taste. When broken the fresh surfaces have a milky-white color. |
| Synonyms: |
2-Hydroxy-1,2-diphenylethanone;2-hydroxy-2-phenylacetophenone;Alpha-hydroxy-a-phenylacetophenone;Alpha-hydroxybenzyl phenyl ketone;benzoylphenylcarbinol;bitter almond oil camphor;hydroxy-2-phenyl acetophenone;DL-benzoin; |
| Molecular Structure: |
|
if you are sourcing Benzoin from Italy ,just feel free to inquire