| Category: |
Pharmaceuticals and Biochemicals/Central nervous system depressants and stimulants |
|
| CAS NO: |
22345-47-7 |
| EC NO: |
244-922-3 |
| Molecular Formula: |
C22H26N2O4 |
| Molecular Weight: |
382.4528 |
| Specification: |
|
| InChI: |
InChI=1/C22H26N2O4/c1-7-15-13(2)23-24-22(14-8-9-18(25-3)19(10-14)26-4)17-12-21(28-6)20(27-5)11-16(15)17/h8-12,15H,7H2,1-6H3 |
Product description:
Possesses anxiolytic properties but unlike other benzodiazepines it does not have anticonvulsant, sedative, skeletal muscle relaxant, motor skill-impairing or amnestic properties. |
| Synonyms: |
1-(3,4-Dimethoxyphenyl)-5-ethyl-7,8-dimethoxy-4-methyl-5H-2,3-benzodiazepine; |
| Molecular Structure: |
|