Details for Stearyl methacrylate

Stearyl methacrylate
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
112-08-3 |
| EC NO: |
251-013-5 |
| Molecular Formula: |
C22H42O2 |
| Molecular Weight: |
338.5677 |
| Specification: |
|
| InChI: |
InChI=1/C22H42O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-22(23)21(2)3/h2,4-20H2,1,3H3 |
| Synonyms: |
2-propenoic acid, 2-methyl-, octadecyl ester;octadecyl 2-methyl-2-propenoate;Octadecyl 2-methylacrylate;octadecyl 2-methylprop-2-enoate;;Stearyl methacrylate;Methacrylic acid stearyl ester; |
| Molecular Structure: |
|
if you are sourcing Stearyl methacrylate from Japan ,just feel free to inquire