| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
50-81-7 |
| EC NO: |
200-066-2 |
| Molecular Formula: |
C6H8O6 |
| Molecular Weight: |
176.1241 |
| Specification: |
|
| InChI: |
InChI=1/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2 |
Product description:
White crystals.As antioxidant in foodstuffs, to prevent rancidity, to prevent browning of cut apples & other fruit. |
| Synonyms: |
L-Ascorbic Acid, Free Acid;Vitamin C;L-(+)-Ascorbic acid;VC;ascorbic acid;Vita C BP2005;Vitamine C;L-threo-hex-1-enofuranos-3-ulose;(5R)-5-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxyfuran-2(5H)-one (non-preferred name);5-(1,2-dihydroxyethyl)-3,4-dihydroxyfuran-2(5H)-one (non-preferred name);Vit.C;Ascorbic Acid(VC);L-Ascorbic Acid;Ascorbate Acid;COATED ASCORBIC ACID; |
| Molecular Structure: |
|