Details for Ethyl acetate

Ethyl acetate
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
141-78-6 |
| EC NO: |
205-500-4 |
| Molecular Formula: |
C4H8O2 |
| Molecular Weight: |
88.1051 |
| Specification: |
|
| InChI: |
InChI=1/C4H8O2/c1-3-6-4(2)5/h3H2,1-2H3 |
| Synonyms: |
Acetic acid ethyl ester;ethyl acetate B&J brand 4 L;ETHYLACETATE ULTRA RESI-ANAL.;ETHYL ACETATE CAPILLARY GRADE;Ethyl Acetate Specially Purified - SPECIFIED;Acetic Ether;RFE;acetic ester;EAC; |
| Molecular Structure: |
|
if you are sourcing Ethyl acetate from Spain ,just feel free to inquire