Details for Ethyl Hexanoate

Ethyl Hexanoate
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
123-66-0 |
| EC NO: |
204-640-3 |
| Molecular Formula: |
C8H16O2 |
| Molecular Weight: |
144.2114 |
| Specification: |
|
| InChI: |
InChI=1/C8H16O2/c1-3-5-6-7-8(9)10-4-2/h3-7H2,1-2H3 |
| Synonyms: |
Ethyl hexanoate;ethyl caproate (ethyl hexanoate);Caproic acid ethyl ester;Hexanoic acid ethyl ester;NATURAL ETHYL HEXANOATE;ethyl caproate; |
| Molecular Structure: |
|
if you are sourcing Ethyl Hexanoate from United-Kingdom ,just feel free to inquire