Details for D Mandelic Acid

D Mandelic Acid
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
611-71-2 |
| EC NO: |
210-276-6 |
| Molecular Formula: |
C9H10O3 |
| Molecular Weight: |
166.1739 |
| Specification: |
|
| InChI: |
InChI=1/C9H10O3/c1-6(10)7-4-2-3-5-8(7)9(11)12/h2-6,10H,1H3,(H,11,12)/t6-/m1/s1 |
| Synonyms: |
(R)-(-)-alpha-hydroxyphenylacetic acid;d-minus-mandelic acid sigma grade;r-(-)-mandelic acid;(r)-(-)-mandelic;(r)-hydroxyphenylaceticacid;rarechem al bo 1446;(r)-(-)-2-mandelic acid;(r)-2-hydroxy-2-phenylacetic acid;(r)-(-)-amygdalic acid;(r)-alpha-hydroxyphenylacetic acid;r-(-)-alpha-hydroxyphenylacetic acid;d-mandelic acid;d-dl-mandelic acid;r-(-)-dl-mandelic acid;r-dl-mandelic acid;(r)-mandelic acid;D-(-)-mandelic acid;R-mandelic acid;(2R)-hydroxy(phenyl)ethanoate;2-[(1R)-1-hydroxyethyl]benzoic acid;R-MDA;(R)-Mandelic acid; |
| Molecular Structure: |
|
if you are sourcing D Mandelic Acid from United-States ,just feel free to inquire