Details for BENZOIC ACID

BENZOIC ACID
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
65-85-0 |
| EC NO: |
200-618-2 |
| Molecular Formula: |
C7H6O2 |
| Molecular Weight: |
122.1224 |
| Specification: |
|
| InChI: |
InChI=1/C7H6O2/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H,8,9)/p-1 |
| Synonyms: |
Melting point standard benzoic acid;Benzoic-12C7 acid, 13C-depleted;Benzoic acid, USP Grade;4-Carboxypolystyrene;benzoate;Industrial-use benzoic acid; |
| Molecular Structure: |
|
if you are sourcing BENZOIC ACID from United-States ,just feel free to inquire