Details for 1,8-Diamino-p-menthane

1,8-Diamino-p-menthane
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
80-52-4 |
| EC NO: |
201-287-7 |
| Molecular Formula: |
C10H26N2 |
| Molecular Weight: |
174.3268 |
| Specification: |
68% min |
| InChI: |
InChI=1/C10H20.2H3N/c1-8(2)10-6-4-9(3)5-7-10;;/h8-10H,4-7H2,1-3H3;2*1H3 |
| Packing: |
190kg/drum |
Product description:
alias:p-Menthane-1,8-diamine;Menthanediamine;MDA
|
| Uses: |
use for the curing agent of epoxy resin |
| Synonyms: |
p-menthane-1,8-diyldiamine;p-menthane-1,8-diamine;1-methyl-4-(propan-2-yl)cyclohexanato diammoniate; |
| Molecular Structure: |
|
if you are sourcing 1,8-Diamino-p-menthane from United-States ,just feel free to inquire