Details for 1-Methyl-Aminomethyl Naphthalene HCL

1-Methyl-Aminomethyl Naphthalene HCL
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
65473-13-4 |
| EC NO: |
|
| Molecular Formula: |
C12H14N |
| Molecular Weight: |
172.2457 |
| Specification: |
|
| InChI: |
InChI=1/C12H13N/c1-13-9-11-7-4-6-10-5-2-3-8-12(10)11/h2-8,13H,9H2,1H3/p+1 |
| Synonyms: |
N-Methyl-1-Naphthalenemethyl amine hydrochloride;N-Methyl-1-naphthalenemethyl amine HCL;1-Methyl-aminomethyl Naphthalene HCL;N-methyl(naphthalen-1-yl)methanaminium;N-METHYL-2-NAPHTHALENE-METHANAMINE HCL;N-Methyl-1-Naphthylmethyl Amine Hcl;N-Methyl-1-naphthylmethylamine Hydrochloride;N-Methyl-1-Naphthalenemethylamine Hcl; |
| Molecular Structure: |
|
if you are sourcing 1-Methyl-Aminomethyl Naphthalene HCL from United-States ,just feel free to inquire