Details for Potassium Lactate

Potassium Lactate
| Category: |
Catalyst and Auxiliary |
|
| CAS NO: |
996-31-6 |
| EC NO: |
213-631-3 |
| Molecular Formula: |
C3H5KO3 |
| Molecular Weight: |
128.1683 |
| Specification: |
|
| InChI: |
InChI=1/C3H6O3.K/c1-2(4)3(5)6;/h2,4H,1H3,(H,5,6);/q;+1/p-1/t2-;/m0./s1 |
| Synonyms: |
Potassium Lactate, 60% Aqueoussoln.;Propanoic acid, 2-hydroxy-, monopotassium salt;potassium L-lactate solution;potassium 2-hydroxypropanoate;potassium (2S)-2-hydroxypropanoate; |
| Molecular Structure: |
|
if you are sourcing Potassium Lactate from United-States ,just feel free to inquire