Details for STEARIC ACID

STEARIC ACID
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
57-11-4 |
| EC NO: |
200-313-4 |
| Molecular Formula: |
C18H36O2 |
| Molecular Weight: |
284.48 |
| Specification: |
|
| InChI: |
InChI=1/C18H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-17H2,1H3,(H,19,20) |
Product description:
White or slightly yellow, crystals or powder, with a slight tallow-like odor.
|
| Synonyms: |
Octadecanoic acid;n-Octadecan acid;Octadecan acid; |
| Molecular Structure: |
|
if you are sourcing STEARIC ACID from United-States ,just feel free to inquire